2-(2-methylphenyl)-5-[(3-nitrophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Chemical Structure Depiction of
2-(2-methylphenyl)-5-[(3-nitrophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
2-(2-methylphenyl)-5-[(3-nitrophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Compound characteristics
| Compound ID: | 6187-1744 |
| Compound Name: | 2-(2-methylphenyl)-5-[(3-nitrophenyl)methylidene][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one |
| Molecular Weight: | 364.38 |
| Molecular Formula: | C18 H12 N4 O3 S |
| Smiles: | [H]C(=C1/C(n2c(nc(c3ccccc3C)n2)S1)=O)\c1cccc(c1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.983 |
| logD: | 3.983 |
| logSw: | -4.2681 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.577 |
| InChI Key: | WZNVJKHGWHJFEE-UHFFFAOYSA-N |