6-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]-4H-1-benzopyran-4-imine
Chemical Structure Depiction of
6-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]-4H-1-benzopyran-4-imine
6-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]-4H-1-benzopyran-4-imine
Compound characteristics
| Compound ID: | 6197-5135 |
| Compound Name: | 6-chloro-2-phenyl-N-[3-(trifluoromethyl)phenyl]-4H-1-benzopyran-4-imine |
| Molecular Weight: | 399.8 |
| Molecular Formula: | C22 H13 Cl F3 N O |
| Smiles: | C1=C(c2ccccc2)Oc2ccc(cc2C\1=N/c1cccc(c1)C(F)(F)F)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.2155 |
| logD: | 5.186 |
| logSw: | -6.9204 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.0079 |
| InChI Key: | HRXLGIOJHGFTQM-UHFFFAOYSA-N |