(4-chlorophenyl)methyl N-(thiophene-2-carbonyl)glycylglycinate
Chemical Structure Depiction of
(4-chlorophenyl)methyl N-(thiophene-2-carbonyl)glycylglycinate
(4-chlorophenyl)methyl N-(thiophene-2-carbonyl)glycylglycinate
Compound characteristics
| Compound ID: | 6199-3223 |
| Compound Name: | (4-chlorophenyl)methyl N-(thiophene-2-carbonyl)glycylglycinate |
| Molecular Weight: | 366.82 |
| Molecular Formula: | C16 H15 Cl N2 O4 S |
| Smiles: | C(C(NCC(=O)OCc1ccc(cc1)[Cl])=O)NC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9691 |
| logD: | 2.9691 |
| logSw: | -3.4051 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.676 |
| InChI Key: | UIKJGARBOREAPL-UHFFFAOYSA-N |