4-(2-{[(2-methoxyphenyl)carbamothioyl]amino}ethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-(2-{[(2-methoxyphenyl)carbamothioyl]amino}ethyl)benzene-1-sulfonamide
4-(2-{[(2-methoxyphenyl)carbamothioyl]amino}ethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 6208-0597 |
| Compound Name: | 4-(2-{[(2-methoxyphenyl)carbamothioyl]amino}ethyl)benzene-1-sulfonamide |
| Molecular Weight: | 365.47 |
| Molecular Formula: | C16 H19 N3 O3 S2 |
| Smiles: | COc1ccccc1NC(NCCc1ccc(cc1)S(N)(=O)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 1.6236 |
| logD: | 1.6229 |
| logSw: | -2.1264 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 77.76 |
| InChI Key: | YPDZJSRAEIEVBA-UHFFFAOYSA-N |