3-(hydroxymethyl)-N-(4-phenoxyphenyl)piperidine-1-carbothioamide
Chemical Structure Depiction of
3-(hydroxymethyl)-N-(4-phenoxyphenyl)piperidine-1-carbothioamide
3-(hydroxymethyl)-N-(4-phenoxyphenyl)piperidine-1-carbothioamide
Compound characteristics
| Compound ID: | 6208-0850 |
| Compound Name: | 3-(hydroxymethyl)-N-(4-phenoxyphenyl)piperidine-1-carbothioamide |
| Molecular Weight: | 342.46 |
| Molecular Formula: | C19 H22 N2 O2 S |
| Smiles: | C1CC(CN(C1)C(Nc1ccc(cc1)Oc1ccccc1)=S)CO |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.202 |
| logD: | 4.202 |
| logSw: | -4.2051 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.933 |
| InChI Key: | MTROIGXNHBRXPK-HNNXBMFYSA-N |