N-{[4-(dimethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-(3-methylphenoxy)acetamide
					Chemical Structure Depiction of
N-{[4-(dimethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-(3-methylphenoxy)acetamide
			N-{[4-(dimethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-(3-methylphenoxy)acetamide
Compound characteristics
| Compound ID: | 6214-0674 | 
| Compound Name: | N-{[4-(dimethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)-2-(3-methylphenoxy)acetamide | 
| Molecular Weight: | 416.54 | 
| Molecular Formula: | C22 H28 N2 O4 S | 
| Smiles: | Cc1cccc(c1)OCC(N(Cc1ccc(cc1)N(C)C)C1CCS(C1)(=O)=O)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.3358 | 
| logD: | 2.3204 | 
| logSw: | -2.7387 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 53.636 | 
| InChI Key: | ZXSPAIXDBQKSET-HXUWFJFHSA-N | 
 
				 
				