4-chloro-N-[5-(4-methoxyphthalazin-1-yl)-2-(morpholin-4-yl)phenyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-[5-(4-methoxyphthalazin-1-yl)-2-(morpholin-4-yl)phenyl]benzene-1-sulfonamide
4-chloro-N-[5-(4-methoxyphthalazin-1-yl)-2-(morpholin-4-yl)phenyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 6216-0179 |
| Compound Name: | 4-chloro-N-[5-(4-methoxyphthalazin-1-yl)-2-(morpholin-4-yl)phenyl]benzene-1-sulfonamide |
| Molecular Weight: | 511 |
| Molecular Formula: | C25 H23 Cl N4 O4 S |
| Smiles: | COc1c2ccccc2c(c2ccc(c(c2)NS(c2ccc(cc2)[Cl])(=O)=O)N2CCOCC2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.9239 |
| logD: | 3.2336 |
| logSw: | -5.1136 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.522 |
| InChI Key: | ILWJNMUUFMBEHU-UHFFFAOYSA-N |