3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-2H-1-benzopyran-2-one
3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 6220-3452 |
| Compound Name: | 3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-2H-1-benzopyran-2-one |
| Molecular Weight: | 324.33 |
| Molecular Formula: | C19 H16 O5 |
| Smiles: | COc1ccc(C(CC2=Cc3ccccc3OC2=O)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.4406 |
| logD: | 3.4406 |
| logSw: | -3.886 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.31 |
| InChI Key: | IUVKYCAOOFHBTR-UHFFFAOYSA-N |