1-[(4-bromophenyl)methyl]-2-(phenylmethanesulfonyl)-1H-benzimidazole
Chemical Structure Depiction of
1-[(4-bromophenyl)methyl]-2-(phenylmethanesulfonyl)-1H-benzimidazole
1-[(4-bromophenyl)methyl]-2-(phenylmethanesulfonyl)-1H-benzimidazole
Compound characteristics
| Compound ID: | 6220-3666 |
| Compound Name: | 1-[(4-bromophenyl)methyl]-2-(phenylmethanesulfonyl)-1H-benzimidazole |
| Molecular Weight: | 441.34 |
| Molecular Formula: | C21 H17 Br N2 O2 S |
| Smiles: | C(c1ccc(cc1)[Br])n1c2ccccc2nc1S(Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1635 |
| logD: | 5.1635 |
| logSw: | -5.4829 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.885 |
| InChI Key: | WBPFHELBCWOMGF-UHFFFAOYSA-N |