1-(4-methoxyphenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
1-(4-methoxyphenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
1-(4-methoxyphenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | 6223-0038 |
| Compound Name: | 1-(4-methoxyphenyl)-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 245.28 |
| Molecular Formula: | C14 H15 N O3 |
| Smiles: | Cc1cc(C(O)=O)c(C)n1c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.6908 |
| logD: | -0.3374 |
| logSw: | -2.9125 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.855 |
| InChI Key: | JPCJXGCPGGBFCU-UHFFFAOYSA-N |