ethyl (4-chloro-3-nitro-1H-pyrazol-1-yl)acetate
Chemical Structure Depiction of
ethyl (4-chloro-3-nitro-1H-pyrazol-1-yl)acetate
ethyl (4-chloro-3-nitro-1H-pyrazol-1-yl)acetate
Compound characteristics
| Compound ID: | 6228-1284 |
| Compound Name: | ethyl (4-chloro-3-nitro-1H-pyrazol-1-yl)acetate |
| Molecular Weight: | 233.61 |
| Molecular Formula: | C7 H8 Cl N3 O4 |
| Smiles: | CCOC(Cn1cc(c(n1)[N+]([O-])=O)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 0.9973 |
| logD: | 0.9973 |
| logSw: | -2.1967 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 68.265 |
| InChI Key: | PJYGVEZLPZKIHO-UHFFFAOYSA-N |