N-(3,4-difluorophenyl)-5-[(3,4-dimethylphenoxy)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-(3,4-difluorophenyl)-5-[(3,4-dimethylphenoxy)methyl]furan-2-carboxamide
N-(3,4-difluorophenyl)-5-[(3,4-dimethylphenoxy)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 6228-1755 |
| Compound Name: | N-(3,4-difluorophenyl)-5-[(3,4-dimethylphenoxy)methyl]furan-2-carboxamide |
| Molecular Weight: | 357.36 |
| Molecular Formula: | C20 H17 F2 N O3 |
| Smiles: | Cc1ccc(cc1C)OCc1ccc(C(Nc2ccc(c(c2)F)F)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.5413 |
| logD: | 5.4725 |
| logSw: | -5.4059 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.399 |
| InChI Key: | JXQZAODABZQEEL-UHFFFAOYSA-N |