(4-benzylpiperidin-1-yl){3-[(2-bromophenoxy)methyl]phenyl}methanone
Chemical Structure Depiction of
(4-benzylpiperidin-1-yl){3-[(2-bromophenoxy)methyl]phenyl}methanone
(4-benzylpiperidin-1-yl){3-[(2-bromophenoxy)methyl]phenyl}methanone
Compound characteristics
| Compound ID: | 6228-1832 |
| Compound Name: | (4-benzylpiperidin-1-yl){3-[(2-bromophenoxy)methyl]phenyl}methanone |
| Molecular Weight: | 464.4 |
| Molecular Formula: | C26 H26 Br N O2 |
| Smiles: | C1CN(CCC1Cc1ccccc1)C(c1cccc(COc2ccccc2[Br])c1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0566 |
| logD: | 6.0566 |
| logSw: | -6.0896 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.9294 |
| InChI Key: | NNLBIRDTJFGGRJ-UHFFFAOYSA-N |