N-cyclohexyl-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide
N-cyclohexyl-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 6228-2048 |
| Compound Name: | N-cyclohexyl-5-[(2-methoxyphenoxy)methyl]furan-2-carboxamide |
| Molecular Weight: | 329.39 |
| Molecular Formula: | C19 H23 N O4 |
| Smiles: | COc1ccccc1OCc1ccc(C(NC2CCCCC2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.8824 |
| logD: | 3.8824 |
| logSw: | -4.09 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.163 |
| InChI Key: | INRNTHKATDLKIE-UHFFFAOYSA-N |