5-[(2-methoxyphenoxy)methyl]-N-[(pyridin-3-yl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-methoxyphenoxy)methyl]-N-[(pyridin-3-yl)methyl]furan-2-carboxamide
5-[(2-methoxyphenoxy)methyl]-N-[(pyridin-3-yl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 6228-2052 |
| Compound Name: | 5-[(2-methoxyphenoxy)methyl]-N-[(pyridin-3-yl)methyl]furan-2-carboxamide |
| Molecular Weight: | 338.36 |
| Molecular Formula: | C19 H18 N2 O4 |
| Smiles: | COc1ccccc1OCc1ccc(C(NCc2cccnc2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.2176 |
| logD: | 2.2175 |
| logSw: | -2.0547 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.956 |
| InChI Key: | IJBWUTKRNXJJTF-UHFFFAOYSA-N |