5-[(2-methoxyphenoxy)methyl]-N-(2-methoxyphenyl)furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-methoxyphenoxy)methyl]-N-(2-methoxyphenyl)furan-2-carboxamide
5-[(2-methoxyphenoxy)methyl]-N-(2-methoxyphenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | 6228-2053 |
| Compound Name: | 5-[(2-methoxyphenoxy)methyl]-N-(2-methoxyphenyl)furan-2-carboxamide |
| Molecular Weight: | 353.37 |
| Molecular Formula: | C20 H19 N O5 |
| Smiles: | COc1ccccc1NC(c1ccc(COc2ccccc2OC)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8467 |
| logD: | 3.8463 |
| logSw: | -4.1414 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.048 |
| InChI Key: | VIBLFMAYNLVULP-UHFFFAOYSA-N |