propan-2-yl 4-({5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl}amino)benzoate
Chemical Structure Depiction of
propan-2-yl 4-({5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl}amino)benzoate
propan-2-yl 4-({5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl}amino)benzoate
Compound characteristics
| Compound ID: | 6228-2058 |
| Compound Name: | propan-2-yl 4-({5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl}amino)benzoate |
| Molecular Weight: | 409.44 |
| Molecular Formula: | C23 H23 N O6 |
| Smiles: | CC(C)OC(c1ccc(cc1)NC(c1ccc(COc2ccccc2OC)o1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.591 |
| logD: | 4.5902 |
| logSw: | -4.522 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.548 |
| InChI Key: | SARBHKDAZLHOOF-UHFFFAOYSA-N |