3-{[(naphthalen-1-yl)oxy]methyl}-N-[(pyridin-3-yl)methyl]benzamide
Chemical Structure Depiction of
3-{[(naphthalen-1-yl)oxy]methyl}-N-[(pyridin-3-yl)methyl]benzamide
3-{[(naphthalen-1-yl)oxy]methyl}-N-[(pyridin-3-yl)methyl]benzamide
Compound characteristics
| Compound ID: | 6228-2102 |
| Compound Name: | 3-{[(naphthalen-1-yl)oxy]methyl}-N-[(pyridin-3-yl)methyl]benzamide |
| Molecular Weight: | 368.43 |
| Molecular Formula: | C24 H20 N2 O2 |
| Smiles: | C(c1cccnc1)NC(c1cccc(COc2cccc3ccccc23)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4621 |
| logD: | 4.462 |
| logSw: | -4.5487 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.212 |
| InChI Key: | DJPOTGMARCZDJT-UHFFFAOYSA-N |