methyl 2-({5-[(3,4-dimethylphenoxy)methyl]furan-2-carbonyl}amino)benzoate
Chemical Structure Depiction of
methyl 2-({5-[(3,4-dimethylphenoxy)methyl]furan-2-carbonyl}amino)benzoate
methyl 2-({5-[(3,4-dimethylphenoxy)methyl]furan-2-carbonyl}amino)benzoate
Compound characteristics
| Compound ID: | 6228-2338 |
| Compound Name: | methyl 2-({5-[(3,4-dimethylphenoxy)methyl]furan-2-carbonyl}amino)benzoate |
| Molecular Weight: | 379.41 |
| Molecular Formula: | C22 H21 N O5 |
| Smiles: | Cc1ccc(cc1C)OCc1ccc(C(Nc2ccccc2C(=O)OC)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.1075 |
| logD: | 4.9963 |
| logSw: | -4.9626 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.875 |
| InChI Key: | GBCINTJBDABOFD-UHFFFAOYSA-N |