5-[(2-methoxy-4-propylphenoxy)methyl]-N-propylfuran-2-carboxamide
					Chemical Structure Depiction of
5-[(2-methoxy-4-propylphenoxy)methyl]-N-propylfuran-2-carboxamide
			5-[(2-methoxy-4-propylphenoxy)methyl]-N-propylfuran-2-carboxamide
Compound characteristics
| Compound ID: | 6228-2462 | 
| Compound Name: | 5-[(2-methoxy-4-propylphenoxy)methyl]-N-propylfuran-2-carboxamide | 
| Molecular Weight: | 331.41 | 
| Molecular Formula: | C19 H25 N O4 | 
| Smiles: | CCCc1ccc(c(c1)OC)OCc1ccc(C(NCCC)=O)o1 | 
| Stereo: | ACHIRAL | 
| logP: | 3.973 | 
| logD: | 3.973 | 
| logSw: | -4.0662 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 47.551 | 
| InChI Key: | LZMZQXSSJLBDFF-UHFFFAOYSA-N | 
 
				 
				