5-[(2-bromophenoxy)methyl]-N-(3,4,5-trimethoxyphenyl)furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-bromophenoxy)methyl]-N-(3,4,5-trimethoxyphenyl)furan-2-carboxamide
5-[(2-bromophenoxy)methyl]-N-(3,4,5-trimethoxyphenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | 6228-2530 |
| Compound Name: | 5-[(2-bromophenoxy)methyl]-N-(3,4,5-trimethoxyphenyl)furan-2-carboxamide |
| Molecular Weight: | 462.3 |
| Molecular Formula: | C21 H20 Br N O6 |
| Smiles: | COc1cc(cc(c1OC)OC)NC(c1ccc(COc2ccccc2[Br])o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1182 |
| logD: | 4.1152 |
| logSw: | -4.404 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.463 |
| InChI Key: | NXXNVRTZCWKFAL-UHFFFAOYSA-N |