2-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2-methylpropanal
Chemical Structure Depiction of
2-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2-methylpropanal
2-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2-methylpropanal
Compound characteristics
| Compound ID: | 6232-2814 |
| Compound Name: | 2-(1,4-dioxo-1,4-dihydronaphthalen-2-yl)-2-methylpropanal |
| Molecular Weight: | 228.24 |
| Molecular Formula: | C14 H12 O3 |
| Smiles: | CC(C)(C=O)C1=CC(c2ccccc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4883 |
| logD: | 2.4883 |
| logSw: | -2.8892 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.713 |
| InChI Key: | RBXCNNSCGNJMLF-UHFFFAOYSA-N |