5'-methyl-1-[(morpholin-4-yl)methyl]-3'-[3-(trifluoromethyl)phenyl]spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
Chemical Structure Depiction of
5'-methyl-1-[(morpholin-4-yl)methyl]-3'-[3-(trifluoromethyl)phenyl]spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
5'-methyl-1-[(morpholin-4-yl)methyl]-3'-[3-(trifluoromethyl)phenyl]spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione
Compound characteristics
| Compound ID: | 6232-3439 |
| Compound Name: | 5'-methyl-1-[(morpholin-4-yl)methyl]-3'-[3-(trifluoromethyl)phenyl]spiro[indole-3,2'-[1,3]thiazolidine]-2,4'(1H)-dione |
| Molecular Weight: | 477.5 |
| Molecular Formula: | C23 H22 F3 N3 O3 S |
| Smiles: | CC1C(N(c2cccc(c2)C(F)(F)F)C2(C(N(CN3CCOCC3)c3ccccc23)=O)S1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7029 |
| logD: | 3.5106 |
| logSw: | -4.0512 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 44.093 |
| InChI Key: | HCTKKPBRWORMSZ-UHFFFAOYSA-N |