3,3-dichloro-8a-methyl-3a,8a-dihydro-2H-indeno[2,1-b]furan-2,8(3H)-dione
Chemical Structure Depiction of
3,3-dichloro-8a-methyl-3a,8a-dihydro-2H-indeno[2,1-b]furan-2,8(3H)-dione
3,3-dichloro-8a-methyl-3a,8a-dihydro-2H-indeno[2,1-b]furan-2,8(3H)-dione
Compound characteristics
| Compound ID: | 6254-0022 |
| Compound Name: | 3,3-dichloro-8a-methyl-3a,8a-dihydro-2H-indeno[2,1-b]furan-2,8(3H)-dione |
| Molecular Weight: | 271.1 |
| Molecular Formula: | C12 H8 Cl2 O3 |
| Smiles: | CC12C(c3ccccc3C1=O)C(C(=O)O2)([Cl])[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.9966 |
| logD: | 2.9966 |
| logSw: | -3.6258 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.18 |
| InChI Key: | KPXCKOURCOENFH-UHFFFAOYSA-N |