5-({1-[4-(diethylamino)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}methylidene)-3-ethylimidazolidine-2,4-dione
Chemical Structure Depiction of
5-({1-[4-(diethylamino)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}methylidene)-3-ethylimidazolidine-2,4-dione
5-({1-[4-(diethylamino)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}methylidene)-3-ethylimidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 6266-2019 |
| Compound Name: | 5-({1-[4-(diethylamino)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}methylidene)-3-ethylimidazolidine-2,4-dione |
| Molecular Weight: | 380.49 |
| Molecular Formula: | C22 H28 N4 O2 |
| Smiles: | CCN(CC)c1ccc(cc1)n1c(C)cc(\C=C2/C(N(CC)C(N2)=O)=O)c1C |
| Stereo: | ACHIRAL |
| logP: | 3.6366 |
| logD: | 3.5667 |
| logSw: | -3.708 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.068 |
| InChI Key: | KYDAFKXENXYVDQ-UHFFFAOYSA-N |