4-methyl-N-[4-oxo-2-(thiophen-2-yl)-1,4-dihydroquinazolin-3(2H)-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-methyl-N-[4-oxo-2-(thiophen-2-yl)-1,4-dihydroquinazolin-3(2H)-yl]benzene-1-sulfonamide
4-methyl-N-[4-oxo-2-(thiophen-2-yl)-1,4-dihydroquinazolin-3(2H)-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 6267-0087 |
| Compound Name: | 4-methyl-N-[4-oxo-2-(thiophen-2-yl)-1,4-dihydroquinazolin-3(2H)-yl]benzene-1-sulfonamide |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C19 H17 N3 O3 S2 |
| Smiles: | Cc1ccc(cc1)S(NN1C(c2cccs2)Nc2ccccc2C1=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.361 |
| logD: | 3.3602 |
| logSw: | -3.8725 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.449 |
| InChI Key: | YUIOJGBMSLFMRL-SFHVURJKSA-N |