2-[4-(2,3-dihydro-1H-perimidin-2-yl)phenoxy]-N-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
2-[4-(2,3-dihydro-1H-perimidin-2-yl)phenoxy]-N-(4-fluorophenyl)acetamide
2-[4-(2,3-dihydro-1H-perimidin-2-yl)phenoxy]-N-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | 6268-0070 |
| Compound Name: | 2-[4-(2,3-dihydro-1H-perimidin-2-yl)phenoxy]-N-(4-fluorophenyl)acetamide |
| Molecular Weight: | 413.45 |
| Molecular Formula: | C25 H20 F N3 O2 |
| Smiles: | C(C(Nc1ccc(cc1)F)=O)Oc1ccc(cc1)C1Nc2cccc3cccc(c23)N1 |
| Stereo: | ACHIRAL |
| logP: | 4.859 |
| logD: | 4.8589 |
| logSw: | -5.7021 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 52.96 |
| InChI Key: | CYMXYHXOZKAVML-UHFFFAOYSA-N |