N-(2,5-dichlorophenyl)-2-(2-oxo-1,3-benzoxazol-3(2H)-yl)acetamide
					Chemical Structure Depiction of
N-(2,5-dichlorophenyl)-2-(2-oxo-1,3-benzoxazol-3(2H)-yl)acetamide
			N-(2,5-dichlorophenyl)-2-(2-oxo-1,3-benzoxazol-3(2H)-yl)acetamide
Compound characteristics
| Compound ID: | 6313-0056 | 
| Compound Name: | N-(2,5-dichlorophenyl)-2-(2-oxo-1,3-benzoxazol-3(2H)-yl)acetamide | 
| Molecular Weight: | 337.16 | 
| Molecular Formula: | C15 H10 Cl2 N2 O3 | 
| Smiles: | C(C(Nc1cc(ccc1[Cl])[Cl])=O)N1C(=O)Oc2ccccc12 | 
| Stereo: | ACHIRAL | 
| logP: | 3.462 | 
| logD: | 3.4516 | 
| logSw: | -3.8974 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 45.519 | 
| InChI Key: | SVCCNAMTTYBAQR-UHFFFAOYSA-N | 
 
				 
				