rel-(5R,7S)-7-(3-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
Chemical Structure Depiction of
rel-(5R,7S)-7-(3-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
rel-(5R,7S)-7-(3-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
Compound characteristics
| Compound ID: | 6321-0323 |
| Compound Name: | rel-(5R,7S)-7-(3-chlorophenyl)-5-(4-methoxyphenyl)-4,5,6,7-tetrahydro[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| Molecular Weight: | 355.83 |
| Molecular Formula: | C18 H18 Cl N5 O |
| Smiles: | COc1ccc(cc1)[C@@H]1C[C@H](c2cccc(c2)[Cl])n2c(N1)nc(N)n2 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.6783 |
| logD: | 3.5916 |
| logSw: | -4.2295 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 66.138 |
| InChI Key: | AZJUETRGZAYPMI-HOTGVXAUSA-N |