N-(3-fluorophenyl)-2-(4-methylanilino)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
Chemical Structure Depiction of
N-(3-fluorophenyl)-2-(4-methylanilino)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
N-(3-fluorophenyl)-2-(4-methylanilino)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
Compound characteristics
| Compound ID: | 6359-0248 |
| Compound Name: | N-(3-fluorophenyl)-2-(4-methylanilino)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide |
| Molecular Weight: | 357.4 |
| Molecular Formula: | C18 H16 F N3 O2 S |
| Smiles: | Cc1ccc(cc1)NC1=NC(CC(C(Nc2cccc(c2)F)=O)S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4118 |
| logD: | 3.4108 |
| logSw: | -3.706 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.564 |
| InChI Key: | VGGYECXKUIKCKZ-HNNXBMFYSA-N |