2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[3-methoxy-4-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[3-methoxy-4-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[3-methoxy-4-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | 6391-0071 |
| Compound Name: | 2-(4,5-dimethyl-1,3-thiazol-2-yl)-1-[3-methoxy-4-(pentyloxy)phenyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 504.6 |
| Molecular Formula: | C28 H28 N2 O5 S |
| Smiles: | CCCCCOc1ccc(cc1OC)C1C2=C(C(N1c1nc(C)c(C)s1)=O)Oc1ccccc1C2=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.093 |
| logD: | 6.0929 |
| logSw: | -5.3721 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.653 |
| InChI Key: | OLGMQTXVTVTWFN-XMMPIXPASA-N |