methyl 2-cyano-3-[2-(2-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate
Chemical Structure Depiction of
methyl 2-cyano-3-[2-(2-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate
methyl 2-cyano-3-[2-(2-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate
Compound characteristics
| Compound ID: | 6392-0560 |
| Compound Name: | methyl 2-cyano-3-[2-(2-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
| Molecular Weight: | 361.36 |
| Molecular Formula: | C20 H15 N3 O4 |
| Smiles: | Cc1ccccc1OC1=C(\C=C(/C#N)C(=O)OC)C(N2C=CC=CC2=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6278 |
| logD: | 2.6278 |
| logSw: | -2.8729 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.059 |
| InChI Key: | PDBUSGFCGAHMIC-UHFFFAOYSA-N |