2-cyano-N-[(furan-2-yl)methyl]-3-[9-methyl-2-(3-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide
Chemical Structure Depiction of
2-cyano-N-[(furan-2-yl)methyl]-3-[9-methyl-2-(3-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide
2-cyano-N-[(furan-2-yl)methyl]-3-[9-methyl-2-(3-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide
Compound characteristics
| Compound ID: | 6392-0786 |
| Compound Name: | 2-cyano-N-[(furan-2-yl)methyl]-3-[9-methyl-2-(3-methylphenoxy)-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| Molecular Weight: | 440.46 |
| Molecular Formula: | C25 H20 N4 O4 |
| Smiles: | CC1=CC=CN2C1=NC(=C(\C=C(/C#N)C(NCc1ccco1)=O)C2=O)Oc1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.588 |
| logD: | 3.5222 |
| logSw: | -3.8467 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.981 |
| InChI Key: | DFIVZHSNYQHVSH-UHFFFAOYSA-N |