3-[2-(2-chlorophenoxy)-9-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]-2-cyanoprop-2-enamide
Chemical Structure Depiction of
3-[2-(2-chlorophenoxy)-9-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]-2-cyanoprop-2-enamide
3-[2-(2-chlorophenoxy)-9-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]-2-cyanoprop-2-enamide
Compound characteristics
| Compound ID: | 6392-0838 |
| Compound Name: | 3-[2-(2-chlorophenoxy)-9-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-3-yl]-2-cyanoprop-2-enamide |
| Molecular Weight: | 380.79 |
| Molecular Formula: | C19 H13 Cl N4 O3 |
| Smiles: | CC1=CC=CN2C1=NC(=C(\C=C(/C#N)C(N)=O)C2=O)Oc1ccccc1[Cl] |
| Stereo: | ACHIRAL |
| logP: | 1.968 |
| logD: | 1.9678 |
| logSw: | -2.668 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.965 |
| InChI Key: | XOLKGINRZZXVRF-UHFFFAOYSA-N |