N-(3-chloro-4-methoxyphenyl)-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
N-(3-chloro-4-methoxyphenyl)-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 6412-0003 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-4,6-bis(morpholin-4-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 406.87 |
| Molecular Formula: | C18 H23 Cl N6 O3 |
| Smiles: | COc1ccc(cc1[Cl])Nc1nc(nc(n1)N1CCOCC1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 4.1353 |
| logD: | 4.1339 |
| logSw: | -4.3787 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.358 |
| InChI Key: | JLTONPRENNPEAR-UHFFFAOYSA-N |