ethyl (4-{[(pyridin-4-yl)methyl]sulfamoyl}phenoxy)acetate
Chemical Structure Depiction of
ethyl (4-{[(pyridin-4-yl)methyl]sulfamoyl}phenoxy)acetate
ethyl (4-{[(pyridin-4-yl)methyl]sulfamoyl}phenoxy)acetate
Compound characteristics
| Compound ID: | 6415-0148 |
| Compound Name: | ethyl (4-{[(pyridin-4-yl)methyl]sulfamoyl}phenoxy)acetate |
| Molecular Weight: | 350.39 |
| Molecular Formula: | C16 H18 N2 O5 S |
| Smiles: | CCOC(COc1ccc(cc1)S(NCc1ccncc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2527 |
| logD: | 1.2422 |
| logSw: | -2.24 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.083 |
| InChI Key: | INMOBAGWVIAPNU-UHFFFAOYSA-N |