N-benzyl-N-phenyl-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]acetamide
Chemical Structure Depiction of
N-benzyl-N-phenyl-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]acetamide
N-benzyl-N-phenyl-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]acetamide
Compound characteristics
| Compound ID: | 6466-0050 |
| Compound Name: | N-benzyl-N-phenyl-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]acetamide |
| Molecular Weight: | 413.44 |
| Molecular Formula: | C23 H22 F3 N3 O |
| Smiles: | C1CCc2c(C1)c(C(F)(F)F)nn2CC(N(Cc1ccccc1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6698 |
| logD: | 4.6698 |
| logSw: | -4.6911 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 29.7144 |
| InChI Key: | PPXWLCMUBREJMT-UHFFFAOYSA-N |