N-benzyl-2-{[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-benzyl-2-{[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetamide
N-benzyl-2-{[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | 6466-0359 |
| Compound Name: | N-benzyl-2-{[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 421.41 |
| Molecular Formula: | C20 H15 F4 N3 O S |
| Smiles: | C(c1ccccc1)NC(CSc1nc(cc(C(F)(F)F)n1)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0196 |
| logD: | 5.0196 |
| logSw: | -5.0925 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.46 |
| InChI Key: | FIVZQRGRSCJDBZ-UHFFFAOYSA-N |