N-[(2-methoxyphenyl)methyl]-2-{[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}propanamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-2-{[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}propanamide
N-[(2-methoxyphenyl)methyl]-2-{[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}propanamide
Compound characteristics
| Compound ID: | 6466-0623 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-2-{[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanyl}propanamide |
| Molecular Weight: | 447.48 |
| Molecular Formula: | C22 H20 F3 N3 O2 S |
| Smiles: | CC(C(NCc1ccccc1OC)=O)Sc1nc(cc(C(F)(F)F)n1)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4836 |
| logD: | 5.4836 |
| logSw: | -5.4241 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.304 |
| InChI Key: | WKABFGCUEJXGPQ-AWEZNQCLSA-N |