7-butoxy-4,8-dimethyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
7-butoxy-4,8-dimethyl-2H-1-benzopyran-2-one
7-butoxy-4,8-dimethyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 6486-0035 |
| Compound Name: | 7-butoxy-4,8-dimethyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 246.3 |
| Molecular Formula: | C15 H18 O3 |
| Smiles: | CCCCOc1ccc2C(C)=CC(=O)Oc2c1C |
| Stereo: | ACHIRAL |
| logP: | 4.0019 |
| logD: | 4.0019 |
| logSw: | -4.252 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 27.8343 |
| InChI Key: | DSKIGNWVOCYLBD-UHFFFAOYSA-N |