6-ethyl-7-hydroxy-4-methyl-8-(prop-2-en-1-yl)-2H-1-benzopyran-2-one
Chemical Structure Depiction of
6-ethyl-7-hydroxy-4-methyl-8-(prop-2-en-1-yl)-2H-1-benzopyran-2-one
6-ethyl-7-hydroxy-4-methyl-8-(prop-2-en-1-yl)-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 6486-0038 |
| Compound Name: | 6-ethyl-7-hydroxy-4-methyl-8-(prop-2-en-1-yl)-2H-1-benzopyran-2-one |
| Molecular Weight: | 244.29 |
| Molecular Formula: | C15 H16 O3 |
| Smiles: | CCc1cc2C(C)=CC(=O)Oc2c(CC=C)c1O |
| Stereo: | ACHIRAL |
| logP: | 3.8138 |
| logD: | 3.8127 |
| logSw: | -3.9158 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.809 |
| InChI Key: | YWKUKNJWDUCNMF-UHFFFAOYSA-N |