1-butyl-1'-[2-(dimethylamino)ethyl]-3'-(4-ethoxybenzoyl)-4'-hydroxyspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
Chemical Structure Depiction of
1-butyl-1'-[2-(dimethylamino)ethyl]-3'-(4-ethoxybenzoyl)-4'-hydroxyspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
1-butyl-1'-[2-(dimethylamino)ethyl]-3'-(4-ethoxybenzoyl)-4'-hydroxyspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
Compound characteristics
| Compound ID: | 6528-0070 |
| Compound Name: | 1-butyl-1'-[2-(dimethylamino)ethyl]-3'-(4-ethoxybenzoyl)-4'-hydroxyspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione |
| Molecular Weight: | 491.59 |
| Molecular Formula: | C28 H33 N3 O5 |
| Smiles: | CCCCN1C(C2(C(=C(C(N2CCN(C)C)=O)O)C(c2ccc(cc2)OCC)=O)c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8067 |
| logD: | 3.3137 |
| logSw: | -3.7244 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.219 |
| InChI Key: | SJCFNIZPRQLVNB-NDEPHWFRSA-N |