1'-[3-(dimethylamino)propyl]-4'-hydroxy-3'-(4-methoxybenzoyl)-1-methylspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
Chemical Structure Depiction of
1'-[3-(dimethylamino)propyl]-4'-hydroxy-3'-(4-methoxybenzoyl)-1-methylspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
1'-[3-(dimethylamino)propyl]-4'-hydroxy-3'-(4-methoxybenzoyl)-1-methylspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione
Compound characteristics
| Compound ID: | 6528-0167 |
| Compound Name: | 1'-[3-(dimethylamino)propyl]-4'-hydroxy-3'-(4-methoxybenzoyl)-1-methylspiro[indole-3,2'-pyrrole]-2,5'(1H,1'H)-dione |
| Molecular Weight: | 449.51 |
| Molecular Formula: | C25 H27 N3 O5 |
| Smiles: | CN(C)CCCN1C(C(=C(C(c2ccc(cc2)OC)=O)C12C(N(C)c1ccccc12)=O)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8943 |
| logD: | 0.0247 |
| logSw: | -2.7702 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.426 |
| InChI Key: | MSWCRLNLNLQQRU-VWLOTQADSA-N |