N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(4-methoxyphenyl)-4H-1-benzopyran-4-imine
Chemical Structure Depiction of
N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(4-methoxyphenyl)-4H-1-benzopyran-4-imine
N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(4-methoxyphenyl)-4H-1-benzopyran-4-imine
Compound characteristics
| Compound ID: | 6557-0031 |
| Compound Name: | N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(4-methoxyphenyl)-4H-1-benzopyran-4-imine |
| Molecular Weight: | 484.57 |
| Molecular Formula: | C28 H24 N2 O4 S |
| Smiles: | Cc1c(c2ccc(c(c2)OC)OC)nc(/N=C2\C=C(c3ccc(cc3)OC)Oc3ccccc23)s1 |
| Stereo: | ACHIRAL |
| logP: | 6.8646 |
| logD: | 6.4181 |
| logSw: | -5.8884 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.358 |
| InChI Key: | SXNZCDXFPBSDDY-UHFFFAOYSA-N |