1,5-dimethyl-3,7-bis(4-methylbenzene-1-sulfonyl)-3,7-diazabicyclo[3.3.1]nonane
Chemical Structure Depiction of
1,5-dimethyl-3,7-bis(4-methylbenzene-1-sulfonyl)-3,7-diazabicyclo[3.3.1]nonane
1,5-dimethyl-3,7-bis(4-methylbenzene-1-sulfonyl)-3,7-diazabicyclo[3.3.1]nonane
Compound characteristics
| Compound ID: | 6583-0300 |
| Compound Name: | 1,5-dimethyl-3,7-bis(4-methylbenzene-1-sulfonyl)-3,7-diazabicyclo[3.3.1]nonane |
| Molecular Weight: | 462.63 |
| Molecular Formula: | C23 H30 N2 O4 S2 |
| Smiles: | Cc1ccc(cc1)S(N1CC2(C)CC(C)(C1)CN(C2)S(c1ccc(C)cc1)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6493 |
| logD: | 4.6493 |
| logSw: | -4.4133 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 63.123 |
| InChI Key: | UVDHTEQPICBLSZ-UHFFFAOYSA-N |