5-methyl-1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-indole-2,3-dione
Chemical Structure Depiction of
5-methyl-1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-indole-2,3-dione
5-methyl-1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-indole-2,3-dione
Compound characteristics
| Compound ID: | 6603-0052 |
| Compound Name: | 5-methyl-1-{2-[5-methyl-2-(propan-2-yl)phenoxy]ethyl}-1H-indole-2,3-dione |
| Molecular Weight: | 337.42 |
| Molecular Formula: | C21 H23 N O3 |
| Smiles: | CC(C)c1ccc(C)cc1OCCN1C(C(c2cc(C)ccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9106 |
| logD: | 4.9106 |
| logSw: | -4.5208 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.336 |
| InChI Key: | NTGIFHALNIQUIM-UHFFFAOYSA-N |