1-[2-(4-chlorophenoxy)ethyl]-5-methyl-1H-indole-2,3-dione
Chemical Structure Depiction of
1-[2-(4-chlorophenoxy)ethyl]-5-methyl-1H-indole-2,3-dione
1-[2-(4-chlorophenoxy)ethyl]-5-methyl-1H-indole-2,3-dione
Compound characteristics
| Compound ID: | 6603-0053 |
| Compound Name: | 1-[2-(4-chlorophenoxy)ethyl]-5-methyl-1H-indole-2,3-dione |
| Molecular Weight: | 315.75 |
| Molecular Formula: | C17 H14 Cl N O3 |
| Smiles: | Cc1ccc2c(c1)C(C(N2CCOc1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7876 |
| logD: | 3.7876 |
| logSw: | -4.1413 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.25 |
| InChI Key: | WHPSCGDVLVDWQI-UHFFFAOYSA-N |