1-(3,4-dihydroquinolin-1(2H)-yl)-2-[3-(thiophene-2-carbonyl)-1H-indol-1-yl]ethan-1-one
Chemical Structure Depiction of
1-(3,4-dihydroquinolin-1(2H)-yl)-2-[3-(thiophene-2-carbonyl)-1H-indol-1-yl]ethan-1-one
1-(3,4-dihydroquinolin-1(2H)-yl)-2-[3-(thiophene-2-carbonyl)-1H-indol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | 6655-0485 |
| Compound Name: | 1-(3,4-dihydroquinolin-1(2H)-yl)-2-[3-(thiophene-2-carbonyl)-1H-indol-1-yl]ethan-1-one |
| Molecular Weight: | 400.5 |
| Molecular Formula: | C24 H20 N2 O2 S |
| Smiles: | C1Cc2ccccc2N(C1)C(Cn1cc(C(c2cccs2)=O)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6629 |
| logD: | 4.6629 |
| logSw: | -4.4203 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.513 |
| InChI Key: | CTRCABWHYUSWDC-UHFFFAOYSA-N |