N-(4-bromophenyl)-2-[2-(4-methylanilino)-4-oxo-4,5-dihydro-1,3-thiazol-5-yl]acetamide
Chemical Structure Depiction of
N-(4-bromophenyl)-2-[2-(4-methylanilino)-4-oxo-4,5-dihydro-1,3-thiazol-5-yl]acetamide
N-(4-bromophenyl)-2-[2-(4-methylanilino)-4-oxo-4,5-dihydro-1,3-thiazol-5-yl]acetamide
Compound characteristics
| Compound ID: | 6721-0773 |
| Compound Name: | N-(4-bromophenyl)-2-[2-(4-methylanilino)-4-oxo-4,5-dihydro-1,3-thiazol-5-yl]acetamide |
| Molecular Weight: | 418.31 |
| Molecular Formula: | C18 H16 Br N3 O2 S |
| Smiles: | Cc1ccc(cc1)NC1=NC(C(CC(Nc2ccc(cc2)[Br])=O)S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1105 |
| logD: | 4.1101 |
| logSw: | -4.1482 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.774 |
| InChI Key: | XDKXBRORFJOYCM-HNNXBMFYSA-N |