4-[4-(2-cyanoethyl)piperazine-1-sulfonyl]-N-cyclohexyl-N-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
4-[4-(2-cyanoethyl)piperazine-1-sulfonyl]-N-cyclohexyl-N-methylbenzene-1-sulfonamide
4-[4-(2-cyanoethyl)piperazine-1-sulfonyl]-N-cyclohexyl-N-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 6732-0162 |
| Compound Name: | 4-[4-(2-cyanoethyl)piperazine-1-sulfonyl]-N-cyclohexyl-N-methylbenzene-1-sulfonamide |
| Molecular Weight: | 454.61 |
| Molecular Formula: | C20 H30 N4 O4 S2 |
| Smiles: | CN(C1CCCCC1)S(c1ccc(cc1)S(N1CCN(CCC#N)CC1)(=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9806 |
| logD: | 1.9805 |
| logSw: | -2.3598 |
| Hydrogen bond acceptors count: | 12 |
| Polar surface area: | 85.886 |
| InChI Key: | XJRHLKGLYCZPNJ-UHFFFAOYSA-N |